2017 (11) TMI 2024

X X   X X   Extracts   X X   X X

→ Full Text of the Document

X X   X X   Extracts   X X   X X

..... r, Mr. VVSS. Kameswara Rao For the Respondent Nos. 1 & 2: Mr. B. Narayana Reddy ORDER (PER HON'BLE SRI JUSTICE C.V. NAGARJUNA REDDY) This Writ Petition is filed for setting aside the proceedings in C.No.VIII/48/52/2016-Cus-CC(HZ), dated 02-02-2017, of respondent No.2, whereby he has declined to compound the offence qua the petitioner under Section 137 of the Customs Act, 1969. The petitioner .....

X X   X X   Extracts   X X   X X

→ Full Text of the Document

X X   X X   Extracts   X X   X X